C5H8F2S2 — CID 162588124
(2,2-difluorocyclopropyl)methylsulfanylmethanethiol (PubChem CID 162588124) has the molecular formula C5H8F2S2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (2,2-difluorocyclopropyl)methylsulfanylmethanethiol.
| Compound Name | (2,2-difluorocyclopropyl)methylsulfanylmethanethiol |
|---|---|
| PubChem CID | 162588124 |
| Molecular Formula | C5H8F2S2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | (2,2-difluorocyclopropyl)methylsulfanylmethanethiol |
| SMILES | FC1(F)CC1CSCS |
| InChI | InChI=1S/C5H8F2S2/c6-5(7)1-4(5)2-9-3-8/h4,8H,1-3H2 |
| InChIKey | FMECOACIEOXVDN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|