C8H13F2NO2 — CID 162591493
(3R,6R)-6-(1,1-difluoroethyl)piperidine-3-carboxylic acid (PubChem CID 162591493) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is (3R,6R)-6-(1,1-difluoroethyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,6R)-6-(1,1-difluoroethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 162591493 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (3R,6R)-6-(1,1-difluoroethyl)piperidine-3-carboxylic acid |
| SMILES | CC(F)(F)[C@H]1CC[C@@H](C(=O)O)CN1 |
| InChI | InChI=1S/C8H13F2NO2/c1-8(9,10)6-3-2-5(4-11-6)7(12)13/h5-6,11H,2-4H2,1H3,(H,12,13)/t5-,6-/m1/s1 |
| InChIKey | IMXZNJQEEOJDCG-PHDIDXHHSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |