C29H18Cl3F3N2O — CID 162594334
2,4-dichloro-6-[(3-chlorophenyl)-methoxy-[6-(trifluoromethyl)-3-pyridinyl]methyl]-3-phenylquinoline (PubChem CID 162594334) has the molecular formula C29H18Cl3F3N2O and a molecular weight of 573.83 g/mol. Its IUPAC name is 2,4-dichloro-6-[(3-chlorophenyl)-methoxy-[6-(trifluoromethyl)-3-pyridinyl]methyl]-3-phenylquinoline.
| Compound Name | 2,4-dichloro-6-[(3-chlorophenyl)-methoxy-[6-(trifluoromethyl)-3-pyridinyl]methyl]-3-phenylquinoline |
|---|---|
| PubChem CID | 162594334 |
| Molecular Formula | C29H18Cl3F3N2O |
| Molecular Weight | 573.83 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | 2,4-dichloro-6-[(3-chlorophenyl)-methoxy-[6-(trifluoromethyl)-3-pyridinyl]methyl]-3-phenylquinoline |
| SMILES | COC(c1ccc(C(F)(F)F)nc1)(c1cccc(Cl)c1)c1ccc2nc(Cl)c(-c3ccccc3)c(Cl)c2c1 |
| InChI | InChI=1S/C29H18Cl3F3N2O/c1-38-28(18-8-5-9-21(30)14-18,20-11-13-24(36-16-20)29(33,34)35)19-10-12-23-22(15-19)26(31)25(27(32)37-23)17-6-3-2-4-7-17/h2-16H,1H3 |
| InChIKey | MFEXDRAKQJUDCH-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.83 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|