C19H16F10N4O4 — CID 162600363
3-[4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]-N-methyl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propanamide (PubChem CID 162600363) has the molecular formula C19H16F10N4O4 and a molecular weight of 554.34 g/mol. Its IUPAC name is 3-[4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]-N-methyl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propanamide.
| Compound Name | 3-[4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]-N-methyl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 162600363 |
| Molecular Formula | C19H16F10N4O4 |
| Molecular Weight | 554.34 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | 3-[4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]-N-methyl-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propanamide |
| SMILES | CN(C(=O)CCc1nc(OCC(F)(F)F)nc(OCC(F)(F)F)n1)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C19H16F10N4O4/c1-33(10-2-4-11(5-3-10)37-19(28,29)14(20)21)13(34)7-6-12-30-15(35-8-17(22,23)24)32-16(31-12)36-9-18(25,26)27/h2-5,14H,6-9H2,1H3 |
| InChIKey | WHOBGEKIBLLPQJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|