C18H12F3IN4O — CID 162600606
5-(1H-indol-3-yl)-N-[4-(trifluoromethoxy)phenyl]-1λ3-ioda-2,6-diazacyclohexa-2,4,6-trien-3-amine (PubChem CID 162600606) has the molecular formula C18H12F3IN4O and a molecular weight of 484.22 g/mol. Its IUPAC name is 5-(1H-indol-3-yl)-N-[4-(trifluoromethoxy)phenyl]-1λ3-ioda-2,6-diazacyclohexa-2,4,6-trien-3-amine.
| Compound Name | 5-(1H-indol-3-yl)-N-[4-(trifluoromethoxy)phenyl]-1λ3-ioda-2,6-diazacyclohexa-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 162600606 |
| Molecular Formula | C18H12F3IN4O |
| Molecular Weight | 484.22 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | 5-(1H-indol-3-yl)-N-[4-(trifluoromethoxy)phenyl]-1λ3-ioda-2,6-diazacyclohexa-2,4,6-trien-3-amine |
| SMILES | FC(F)(F)Oc1ccc(NC2=NI=NC(c3c[nH]c4ccccc34)=C2)cc1 |
| InChI | InChI=1S/C18H12F3IN4O/c19-18(20,21)27-12-7-5-11(6-8-12)24-17-9-16(25-22-26-17)14-10-23-15-4-2-1-3-13(14)15/h1-10,23H,(H,24,25,26) |
| InChIKey | SNIWZYTXKJQANM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.22 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|