C20H17BrF3NO3S — CID 162601458
6-(3-bromophenyl)-8-[4-(trifluoromethyl)phenyl]sulfonyl-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 162601458) has the molecular formula C20H17BrF3NO3S and a molecular weight of 488.33 g/mol. Its IUPAC name is 6-(3-bromophenyl)-8-[4-(trifluoromethyl)phenyl]sulfonyl-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | 6-(3-bromophenyl)-8-[4-(trifluoromethyl)phenyl]sulfonyl-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 162601458 |
| Molecular Formula | C20H17BrF3NO3S |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | 6-(3-bromophenyl)-8-[4-(trifluoromethyl)phenyl]sulfonyl-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | O=C1CC2CC(c3cccc(Br)c3)C(C1)N2S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17BrF3NO3S/c21-14-3-1-2-12(8-14)18-10-15-9-16(26)11-19(18)25(15)29(27,28)17-6-4-13(5-7-17)20(22,23)24/h1-8,15,18-19H,9-11H2 |
| InChIKey | UNGYRPUPMPUPBW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |