C18H22F3N5O3S — CID 162621941
cyclopropanesulfonic acid;(1S,3R,4S)-3-methyl-4-[4-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentan-1-amine (PubChem CID 162621941) has the molecular formula C18H22F3N5O3S and a molecular weight of 445.47 g/mol. Its IUPAC name is cyclopropanesulfonic acid;(1S,3R,4S)-3-methyl-4-[4-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentan-1-amine.
| Compound Name | cyclopropanesulfonic acid;(1S,3R,4S)-3-methyl-4-[4-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 162621941 |
| Molecular Formula | C18H22F3N5O3S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | cyclopropanesulfonic acid;(1S,3R,4S)-3-methyl-4-[4-(trifluoromethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclopentan-1-amine |
| SMILES | C[C@@H]1C[C@H](N)C[C@@H]1n1c(C(F)(F)F)nc2cnc3[nH]ccc3c21.O=S(=O)(O)C1CC1 |
| InChI | InChI=1S/C15H16F3N5.C3H6O3S/c1-7-4-8(19)5-11(7)23-12-9-2-3-20-13(9)21-6-10(12)22-14(23)15(16,17)18;4-7(5,6)3-1-2-3/h2-3,6-8,11H,4-5,19H2,1H3,(H,20,21);3H,1-2H2,(H,4,5,6)/t7-,8+,11+;/m1./s1 |
| InChIKey | MGGKZDWBOZZVCJ-YTMBMSNTSA-N |
| XLogP | 3.27 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|