C16H26F6O7S4 — CID 162622143
cyclohexylmethyl-[2-(oxomethylidene)cyclohexyl]sulfanium;sulfane;trifluoromethanesulfonate;trifluoromethanesulfonic acid (PubChem CID 162622143) has the molecular formula C16H26F6O7S4 and a molecular weight of 572.63 g/mol. Its IUPAC name is cyclohexylmethyl-[2-(oxomethylidene)cyclohexyl]sulfanium;sulfane;trifluoromethanesulfonate;trifluoromethanesulfonic acid.
| Compound Name | cyclohexylmethyl-[2-(oxomethylidene)cyclohexyl]sulfanium;sulfane;trifluoromethanesulfonate;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 162622143 |
| Molecular Formula | C16H26F6O7S4 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.05 |
| IUPAC Name | cyclohexylmethyl-[2-(oxomethylidene)cyclohexyl]sulfanium;sulfane;trifluoromethanesulfonate;trifluoromethanesulfonic acid |
| SMILES | O=C=C1CCCCC1[SH+]CC1CCCCC1.O=S(=O)(O)C(F)(F)F.O=S(=O)([O-])C(F)(F)F.S |
| InChI | InChI=1S/C14H22OS.2CHF3O3S.H2S/c15-10-13-8-4-5-9-14(13)16-11-12-6-2-1-3-7-12;2*2-1(3,4)8(5,6)7;/h12,14H,1-9,11H2;2*(H,5,6,7);1H2 |
| InChIKey | NPGAWUAHEJVTTP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|