C19H20N2OS — CID 162626593
(3S,4S)-1-(1,3-benzothiazol-7-ylmethyl)-4-phenylpiperidin-3-ol (PubChem CID 162626593) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is (3S,4S)-1-(1,3-benzothiazol-7-ylmethyl)-4-phenylpiperidin-3-ol.
| Compound Name | (3S,4S)-1-(1,3-benzothiazol-7-ylmethyl)-4-phenylpiperidin-3-ol |
|---|---|
| PubChem CID | 162626593 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (3S,4S)-1-(1,3-benzothiazol-7-ylmethyl)-4-phenylpiperidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2cccc3ncsc23)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H20N2OS/c22-18-12-21(10-9-16(18)14-5-2-1-3-6-14)11-15-7-4-8-17-19(15)23-13-20-17/h1-8,13,16,18,22H,9-12H2/t16-,18+/m0/s1 |
| InChIKey | IMEJBOYFTPEYFU-FUHWJXTLSA-N |
| XLogP | 3.65 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |