C17H19ClN2O — CID 162634174
(3S,4R)-1-[(5-chloro-2-pyridinyl)methyl]-4-phenylpiperidin-3-ol (PubChem CID 162634174) has the molecular formula C17H19ClN2O and a molecular weight of 302.81 g/mol. Its IUPAC name is (3S,4R)-1-[(5-chloro-2-pyridinyl)methyl]-4-phenylpiperidin-3-ol.
| Compound Name | (3S,4R)-1-[(5-chloro-2-pyridinyl)methyl]-4-phenylpiperidin-3-ol |
|---|---|
| PubChem CID | 162634174 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (3S,4R)-1-[(5-chloro-2-pyridinyl)methyl]-4-phenylpiperidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2ccc(Cl)cn2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19ClN2O/c18-14-6-7-15(19-10-14)11-20-9-8-16(17(21)12-20)13-4-2-1-3-5-13/h1-7,10,16-17,21H,8-9,11-12H2/t16-,17-/m1/s1 |
| InChIKey | UOQOOUGNTLATCZ-IAGOWNOFSA-N |
| XLogP | 3.09 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |