C19H24N2O2 — CID 162630294
(3aS,6aS)-5-(1-phenylcyclohexanecarbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one (PubChem CID 162630294) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3aS,6aS)-5-(1-phenylcyclohexanecarbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one.
| Compound Name | (3aS,6aS)-5-(1-phenylcyclohexanecarbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 162630294 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3aS,6aS)-5-(1-phenylcyclohexanecarbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
| SMILES | O=C1NC[C@H]2CN(C(=O)C3(c4ccccc4)CCCCC3)C[C@@H]12 |
| InChI | InChI=1S/C19H24N2O2/c22-17-16-13-21(12-14(16)11-20-17)18(23)19(9-5-2-6-10-19)15-7-3-1-4-8-15/h1,3-4,7-8,14,16H,2,5-6,9-13H2,(H,20,22)/t14-,16+/m0/s1 |
| InChIKey | WNKLWOCZQHJADJ-GOEBONIOSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |