C16H22N4O3 — CID 162636982
methyl 5-[[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-methylamino]pyrazine-2-carboxylate (PubChem CID 162636982) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is methyl 5-[[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-methylamino]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-methylamino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 162636982 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | methyl 5-[[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-methylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(N(C)[C@H]2C[C@H]3CC(=O)N(C)C[C@H]3C2)cn1 |
| InChI | InChI=1S/C16H22N4O3/c1-19-9-11-5-12(4-10(11)6-15(19)21)20(2)14-8-17-13(7-18-14)16(22)23-3/h7-8,10-12H,4-6,9H2,1-3H3/t10-,11+,12-/m0/s1 |
| InChIKey | CTRSIMGIUMWUMV-TUAOUCFPSA-N |
| XLogP | 0.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |