C22H24N2O2 — CID 162642029
(E)-3-[6-[(E)-1-(4-methylphenyl)-3-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)prop-1-enyl]-2-pyridinyl]prop-2-enoic acid (PubChem CID 162642029) has the molecular formula C22H24N2O2 and a molecular weight of 356.49 g/mol. Its IUPAC name is (E)-3-[6-[(E)-1-(4-methylphenyl)-3-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)prop-1-enyl]-2-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-[(E)-1-(4-methylphenyl)-3-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)prop-1-enyl]-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162642029 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | (E)-3-[6-[(E)-1-(4-methylphenyl)-3-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)prop-1-enyl]-2-pyridinyl]prop-2-enoic acid |
| SMILES | [2H]C1([2H])N(C/C=C(\c2ccc(C)cc2)c2cccc(/C=C/C(=O)O)n2)C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C22H24N2O2/c1-17-7-9-18(10-8-17)20(13-16-24-14-2-3-15-24)21-6-4-5-19(23-21)11-12-22(25)26/h4-13H,2-3,14-16H2,1H3,(H,25,26)/b12-11+,20-13+/i2D2,3D2,14D2,15D2 |
| InChIKey | PWACSDKDOHSSQD-FLUHWMMLSA-N |
| XLogP | 4.02 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|