C25H30N2O2 — CID 13191767
(E)-6-[6-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]hex-5-enoic acid (PubChem CID 13191767) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (E)-6-[6-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]hex-5-enoic acid.
| Compound Name | (E)-6-[6-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 13191767 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (E)-6-[6-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]hex-5-enoic acid |
| SMILES | Cc1ccc(/C(=C/CN2CCCC2)c2cccc(/C=C/CCCC(=O)O)n2)cc1 |
| InChI | InChI=1S/C25H30N2O2/c1-20-12-14-21(15-13-20)23(16-19-27-17-5-6-18-27)24-10-7-9-22(26-24)8-3-2-4-11-25(28)29/h3,7-10,12-16H,2,4-6,11,17-19H2,1H3,(H,28,29)/b8-3+,23-16- |
| InChIKey | KOMPDDDATMIWQH-NMDAZEQHSA-N |
| XLogP | 5.19 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|