C22H27N3 — CID 67636513
3-[6-[1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-1-en-1-amine (PubChem CID 67636513) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is 3-[6-[1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-1-en-1-amine.
| Compound Name | 3-[6-[1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 67636513 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 3-[6-[1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-1-en-1-amine |
| SMILES | Cc1ccc(C(=CCN2CCCC2)c2cccc(CC=CN)n2)cc1 |
| InChI | InChI=1S/C22H27N3/c1-18-9-11-19(12-10-18)21(13-17-25-15-2-3-16-25)22-8-4-6-20(24-22)7-5-14-23/h4-6,8-14H,2-3,7,15-17,23H2,1H3 |
| InChIKey | GBWMRKVYWBAZTC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |