C27H32N2O2 — CID 10278991
cyclopentyl (E)-3-[6-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-2-enoate (PubChem CID 10278991) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is cyclopentyl (E)-3-[6-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-2-enoate.
| Compound Name | cyclopentyl (E)-3-[6-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 10278991 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | cyclopentyl (E)-3-[6-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-2-enoate |
| SMILES | Cc1ccc(/C(=C\CN2CCCC2)c2cccc(/C=C/C(=O)OC3CCCC3)n2)cc1 |
| InChI | InChI=1S/C27H32N2O2/c1-21-11-13-22(14-12-21)25(17-20-29-18-4-5-19-29)26-10-6-7-23(28-26)15-16-27(30)31-24-8-2-3-9-24/h6-7,10-17,24H,2-5,8-9,18-20H2,1H3/b16-15+,25-17+ |
| InChIKey | AEFQWFDPGWKRNM-ZFZVQQNOSA-N |
| XLogP | 5.42 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|