C24H27N3O5 — CID 70380946
(E)-3-[6-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-2-enamide;oxalic acid (PubChem CID 70380946) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is (E)-3-[6-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-2-enamide;oxalic acid.
| Compound Name | (E)-3-[6-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-2-enamide;oxalic acid |
|---|---|
| PubChem CID | 70380946 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (E)-3-[6-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-2-enamide;oxalic acid |
| SMILES | Cc1ccc(/C(=C\CN2CCCC2)c2cccc(/C=C/C(N)=O)n2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H25N3O.C2H2O4/c1-17-7-9-18(10-8-17)20(13-16-25-14-2-3-15-25)21-6-4-5-19(24-21)11-12-22(23)26;3-1(4)2(5)6/h4-13H,2-3,14-16H2,1H3,(H2,23,26);(H,3,4)(H,5,6)/b12-11+,20-13+; |
| InChIKey | IPEXAVFUXNRDGM-HCFYBUKHSA-N |
| XLogP | 2.57 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|