C19H18ClFN4O4S — CID 162644771
2-amino-N-(4-chloro-3-cyanophenyl)-4-fluoro-5-(4-hydroxypiperidin-1-yl)sulfonylbenzamide (PubChem CID 162644771) has the molecular formula C19H18ClFN4O4S and a molecular weight of 452.90 g/mol. Its IUPAC name is 2-amino-N-(4-chloro-3-cyanophenyl)-4-fluoro-5-(4-hydroxypiperidin-1-yl)sulfonylbenzamide.
| Compound Name | 2-amino-N-(4-chloro-3-cyanophenyl)-4-fluoro-5-(4-hydroxypiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 162644771 |
| Molecular Formula | C19H18ClFN4O4S |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-amino-N-(4-chloro-3-cyanophenyl)-4-fluoro-5-(4-hydroxypiperidin-1-yl)sulfonylbenzamide |
| SMILES | N#Cc1cc(NC(=O)c2cc(S(=O)(=O)N3CCC(O)CC3)c(F)cc2N)ccc1Cl |
| InChI | InChI=1S/C19H18ClFN4O4S/c20-15-2-1-12(7-11(15)10-22)24-19(27)14-8-18(16(21)9-17(14)23)30(28,29)25-5-3-13(26)4-6-25/h1-2,7-9,13,26H,3-6,23H2,(H,24,27) |
| InChIKey | KQEOULCCCCMIER-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|