C20H18ClFN2O4S — CID 130397505
4-chloro-N-(3-cyano-4-fluorophenyl)-3-(4-hydroxycyclohexyl)sulfonylbenzamide (PubChem CID 130397505) has the molecular formula C20H18ClFN2O4S and a molecular weight of 436.89 g/mol. Its IUPAC name is 4-chloro-N-(3-cyano-4-fluorophenyl)-3-(4-hydroxycyclohexyl)sulfonylbenzamide.
| Compound Name | 4-chloro-N-(3-cyano-4-fluorophenyl)-3-(4-hydroxycyclohexyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 130397505 |
| Molecular Formula | C20H18ClFN2O4S |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 4-chloro-N-(3-cyano-4-fluorophenyl)-3-(4-hydroxycyclohexyl)sulfonylbenzamide |
| SMILES | N#Cc1cc(NC(=O)c2ccc(Cl)c(S(=O)(=O)C3CCC(O)CC3)c2)ccc1F |
| InChI | InChI=1S/C20H18ClFN2O4S/c21-17-7-1-12(20(26)24-14-2-8-18(22)13(9-14)11-23)10-19(17)29(27,28)16-5-3-15(25)4-6-16/h1-2,7-10,15-16,25H,3-6H2,(H,24,26) |
| InChIKey | IPPPRUYGWVAUBY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |