C15H9ClF2N2O3S — CID 2769249
2-chloro-N-(3-cyano-4-methylsulfonylphenyl)-4,5-difluorobenzamide (PubChem CID 2769249) has the molecular formula C15H9ClF2N2O3S and a molecular weight of 370.76 g/mol. Its IUPAC name is 2-chloro-N-(3-cyano-4-methylsulfonylphenyl)-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-(3-cyano-4-methylsulfonylphenyl)-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 2769249 |
| Molecular Formula | C15H9ClF2N2O3S |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 2-chloro-N-(3-cyano-4-methylsulfonylphenyl)-4,5-difluorobenzamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)c2cc(F)c(F)cc2Cl)cc1C#N |
| InChI | InChI=1S/C15H9ClF2N2O3S/c1-24(22,23)14-3-2-9(4-8(14)7-19)20-15(21)10-5-12(17)13(18)6-11(10)16/h2-6H,1H3,(H,20,21) |
| InChIKey | WFAPOTJTYJUSRH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|