C21H14Cl2N2O3S — CID 2769219
2,4-dichloro-N-[3-cyano-4-(4-methylphenyl)sulfonylphenyl]benzamide (PubChem CID 2769219) has the molecular formula C21H14Cl2N2O3S and a molecular weight of 445.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-cyano-4-(4-methylphenyl)sulfonylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-cyano-4-(4-methylphenyl)sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 2769219 |
| Molecular Formula | C21H14Cl2N2O3S |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 2,4-dichloro-N-[3-cyano-4-(4-methylphenyl)sulfonylphenyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(NC(=O)c3ccc(Cl)cc3Cl)cc2C#N)cc1 |
| InChI | InChI=1S/C21H14Cl2N2O3S/c1-13-2-6-17(7-3-13)29(27,28)20-9-5-16(10-14(20)12-24)25-21(26)18-8-4-15(22)11-19(18)23/h2-11H,1H3,(H,25,26) |
| InChIKey | IFUYCCUUDPYIAM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |