C15H10Cl2N2O2S — CID 2769252
2,4-dichloro-N-(3-cyano-4-methylsulfinylphenyl)benzamide (PubChem CID 2769252) has the molecular formula C15H10Cl2N2O2S and a molecular weight of 353.23 g/mol. Its IUPAC name is 2,4-dichloro-N-(3-cyano-4-methylsulfinylphenyl)benzamide.
| Compound Name | 2,4-dichloro-N-(3-cyano-4-methylsulfinylphenyl)benzamide |
|---|---|
| PubChem CID | 2769252 |
| Molecular Formula | C15H10Cl2N2O2S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 2,4-dichloro-N-(3-cyano-4-methylsulfinylphenyl)benzamide |
| SMILES | CS(=O)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1C#N |
| InChI | InChI=1S/C15H10Cl2N2O2S/c1-22(21)14-5-3-11(6-9(14)8-18)19-15(20)12-4-2-10(16)7-13(12)17/h2-7H,1H3,(H,19,20) |
| InChIKey | SADQDTDNTVDYGZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |