C19H12Cl2N2O2 — CID 1187146
2,4-dichloro-N-[3-cyano-5-(4-methylphenyl)furan-2-yl]benzamide (PubChem CID 1187146) has the molecular formula C19H12Cl2N2O2 and a molecular weight of 371.22 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-cyano-5-(4-methylphenyl)furan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-cyano-5-(4-methylphenyl)furan-2-yl]benzamide |
|---|---|
| PubChem CID | 1187146 |
| Molecular Formula | C19H12Cl2N2O2 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2,4-dichloro-N-[3-cyano-5-(4-methylphenyl)furan-2-yl]benzamide |
| SMILES | Cc1ccc(-c2cc(C#N)c(NC(=O)c3ccc(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C19H12Cl2N2O2/c1-11-2-4-12(5-3-11)17-8-13(10-22)19(25-17)23-18(24)15-7-6-14(20)9-16(15)21/h2-9H,1H3,(H,23,24) |
| InChIKey | PDHLKQXCFQFEMM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |