C24H19BrN2OS — CID 162645340
6-(4-bromophenyl)sulfanyl-3-(butylamino)-1-oxophenalene-2-carbonitrile (PubChem CID 162645340) has the molecular formula C24H19BrN2OS and a molecular weight of 463.40 g/mol. Its IUPAC name is 6-(4-bromophenyl)sulfanyl-3-(butylamino)-1-oxophenalene-2-carbonitrile.
| Compound Name | 6-(4-bromophenyl)sulfanyl-3-(butylamino)-1-oxophenalene-2-carbonitrile |
|---|---|
| PubChem CID | 162645340 |
| Molecular Formula | C24H19BrN2OS |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 6-(4-bromophenyl)sulfanyl-3-(butylamino)-1-oxophenalene-2-carbonitrile |
| SMILES | CCCCNC1=C(C#N)C(=O)c2cccc3c(Sc4ccc(Br)cc4)ccc1c23 |
| InChI | InChI=1S/C24H19BrN2OS/c1-2-3-13-27-23-18-11-12-21(29-16-9-7-15(25)8-10-16)17-5-4-6-19(22(17)18)24(28)20(23)14-26/h4-12,27H,2-3,13H2,1H3 |
| InChIKey | XZBIVEYODRPUMU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|