C15H11Br2N5O4 — CID 162646762
3-[[2-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]-3H-benzimidazol-5-yl]amino]-3-oxopropanoic acid (PubChem CID 162646762) has the molecular formula C15H11Br2N5O4 and a molecular weight of 485.09 g/mol. Its IUPAC name is 3-[[2-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]-3H-benzimidazol-5-yl]amino]-3-oxopropanoic acid.
| Compound Name | 3-[[2-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]-3H-benzimidazol-5-yl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 162646762 |
| Molecular Formula | C15H11Br2N5O4 |
| Molecular Weight | 485.09 g/mol |
| Exact Mass | 482.92 |
| IUPAC Name | 3-[[2-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]-3H-benzimidazol-5-yl]amino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)Nc1ccc2nc(NC(=O)c3cc(Br)c(Br)[nH]3)[nH]c2c1 |
| InChI | InChI=1S/C15H11Br2N5O4/c16-7-4-10(19-13(7)17)14(26)22-15-20-8-2-1-6(3-9(8)21-15)18-11(23)5-12(24)25/h1-4,19H,5H2,(H,18,23)(H,24,25)(H2,20,21,22,26) |
| InChIKey | ZHKJYOHLCMVRKW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 139.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.09 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|