C23H19N7O5 — CID 162649773
N-[(E)-[2-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]-5-nitrophenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 162649773) has the molecular formula C23H19N7O5 and a molecular weight of 473.45 g/mol. Its IUPAC name is N-[(E)-[2-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]-5-nitrophenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[2-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]-5-nitrophenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 162649773 |
| Molecular Formula | C23H19N7O5 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[(E)-[2-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]-5-nitrophenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1ccc(-n2cc(COc3ccc([N+](=O)[O-])cc3/C=N/NC(=O)c3ccncc3)nn2)cc1 |
| InChI | InChI=1S/C23H19N7O5/c1-34-21-5-2-19(3-6-21)29-14-18(26-28-29)15-35-22-7-4-20(30(32)33)12-17(22)13-25-27-23(31)16-8-10-24-11-9-16/h2-14H,15H2,1H3,(H,27,31)/b25-13+ |
| InChIKey | GRAUUBYDDXJMTB-DHRITJCHSA-N |
| XLogP | 2.92 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|