C24H29N5O3S — CID 162653370
6-(4-acetylpiperazin-1-yl)-N-[(4-cyanophenyl)methyl]-N-methyl-3,4-dihydro-2H-quinoline-1-sulfonamide (PubChem CID 162653370) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is 6-(4-acetylpiperazin-1-yl)-N-[(4-cyanophenyl)methyl]-N-methyl-3,4-dihydro-2H-quinoline-1-sulfonamide.
| Compound Name | 6-(4-acetylpiperazin-1-yl)-N-[(4-cyanophenyl)methyl]-N-methyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
|---|---|
| PubChem CID | 162653370 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 6-(4-acetylpiperazin-1-yl)-N-[(4-cyanophenyl)methyl]-N-methyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
| SMILES | CC(=O)N1CCN(c2ccc3c(c2)CCCN3S(=O)(=O)N(C)Cc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C24H29N5O3S/c1-19(30)27-12-14-28(15-13-27)23-9-10-24-22(16-23)4-3-11-29(24)33(31,32)26(2)18-21-7-5-20(17-25)6-8-21/h5-10,16H,3-4,11-15,18H2,1-2H3 |
| InChIKey | SEJJDSAJLSCRDT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 87.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|