C23H29ClN4O3S — CID 162653295
6-(4-acetylpiperazin-1-yl)-N-[(3-chlorophenyl)methyl]-N-methyl-3,4-dihydro-2H-quinoline-1-sulfonamide (PubChem CID 162653295) has the molecular formula C23H29ClN4O3S and a molecular weight of 477.03 g/mol. Its IUPAC name is 6-(4-acetylpiperazin-1-yl)-N-[(3-chlorophenyl)methyl]-N-methyl-3,4-dihydro-2H-quinoline-1-sulfonamide.
| Compound Name | 6-(4-acetylpiperazin-1-yl)-N-[(3-chlorophenyl)methyl]-N-methyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
|---|---|
| PubChem CID | 162653295 |
| Molecular Formula | C23H29ClN4O3S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 6-(4-acetylpiperazin-1-yl)-N-[(3-chlorophenyl)methyl]-N-methyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
| SMILES | CC(=O)N1CCN(c2ccc3c(c2)CCCN3S(=O)(=O)N(C)Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H29ClN4O3S/c1-18(29)26-11-13-27(14-12-26)22-8-9-23-20(16-22)6-4-10-28(23)32(30,31)25(2)17-19-5-3-7-21(24)15-19/h3,5,7-9,15-16H,4,6,10-14,17H2,1-2H3 |
| InChIKey | ABZRNKIAVZTUKC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|