C25H34N6O2 — CID 162656701
N-[4-oxo-5-[(4-phenylpiperazin-1-yl)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-2-yl]octanamide (PubChem CID 162656701) has the molecular formula C25H34N6O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is N-[4-oxo-5-[(4-phenylpiperazin-1-yl)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-2-yl]octanamide.
| Compound Name | N-[4-oxo-5-[(4-phenylpiperazin-1-yl)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-2-yl]octanamide |
|---|---|
| PubChem CID | 162656701 |
| Molecular Formula | C25H34N6O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | N-[4-oxo-5-[(4-phenylpiperazin-1-yl)methyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-2-yl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1nc2[nH]cc(CN3CCN(c4ccccc4)CC3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C25H34N6O2/c1-2-3-4-5-9-12-21(32)27-25-28-23-22(24(33)29-25)19(17-26-23)18-30-13-15-31(16-14-30)20-10-7-6-8-11-20/h6-8,10-11,17H,2-5,9,12-16,18H2,1H3,(H3,26,27,28,29,32,33) |
| InChIKey | JUPCUICUDQJENU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|