C25H40N6O4 — CID 162655259
tert-butyl N-[1-[[2-(octanoylamino)-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate (PubChem CID 162655259) has the molecular formula C25H40N6O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(octanoylamino)-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(octanoylamino)-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 162655259 |
| Molecular Formula | C25H40N6O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | tert-butyl N-[1-[[2-(octanoylamino)-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate |
| SMILES | CCCCCCCC(=O)Nc1nc2[nH]cc(CN3CCC(NC(=O)OC(C)(C)C)CC3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C25H40N6O4/c1-5-6-7-8-9-10-19(32)28-23-29-21-20(22(33)30-23)17(15-26-21)16-31-13-11-18(12-14-31)27-24(34)35-25(2,3)4/h15,18H,5-14,16H2,1-4H3,(H,27,34)(H3,26,28,29,30,32,33) |
| InChIKey | UCNOUSGNFVMYHS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|