C25H38N4O5 — CID 87256122
tert-butyl N-[1-[[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-hydroxyphenyl]methyl]piperidin-4-yl]carbamate (PubChem CID 87256122) has the molecular formula C25H38N4O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-hydroxyphenyl]methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-hydroxyphenyl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 87256122 |
| Molecular Formula | C25H38N4O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | tert-butyl N-[1-[[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-hydroxyphenyl]methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Cc2cc(N3CCC(=O)NC3=O)cc(C(C)(C)C)c2O)CC1 |
| InChI | InChI=1S/C25H38N4O5/c1-24(2,3)19-14-18(29-12-9-20(30)27-22(29)32)13-16(21(19)31)15-28-10-7-17(8-11-28)26-23(33)34-25(4,5)6/h13-14,17,31H,7-12,15H2,1-6H3,(H,26,33)(H,27,30,32) |
| InChIKey | ZDXJVTKHHMIIFE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|