C21H31N3O4 — CID 86781855
tert-butyl N-[1-[(7-hydroxy-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-8-yl)methyl]piperidin-4-yl]carbamate (PubChem CID 86781855) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl N-[1-[(7-hydroxy-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-8-yl)methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(7-hydroxy-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-8-yl)methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 86781855 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl N-[1-[(7-hydroxy-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-8-yl)methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Cc2cc3c(cc2O)CCCC(=O)N3)CC1 |
| InChI | InChI=1S/C21H31N3O4/c1-21(2,3)28-20(27)22-16-7-9-24(10-8-16)13-15-11-17-14(12-18(15)25)5-4-6-19(26)23-17/h11-12,16,25H,4-10,13H2,1-3H3,(H,22,27)(H,23,26) |
| InChIKey | GESHSCLHIKJHIH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|