C25H30N6O2 — CID 88531801
tert-butyl N-[1-[[4-(3-ethynylanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate (PubChem CID 88531801) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is tert-butyl N-[1-[[4-(3-ethynylanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[4-(3-ethynylanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 88531801 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | tert-butyl N-[1-[[4-(3-ethynylanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate |
| SMILES | C#Cc1cccc(Nc2ncnc3[nH]cc(CN4CCC(NC(=O)OC(C)(C)C)CC4)c23)c1 |
| InChI | InChI=1S/C25H30N6O2/c1-5-17-7-6-8-20(13-17)29-23-21-18(14-26-22(21)27-16-28-23)15-31-11-9-19(10-12-31)30-24(32)33-25(2,3)4/h1,6-8,13-14,16,19H,9-12,15H2,2-4H3,(H,30,32)(H2,26,27,28,29) |
| InChIKey | NXGZQWQNQYILIK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|