C20H13ClN4 — CID 18473286
5-(4-chlorophenyl)-N-(3-ethynylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 18473286) has the molecular formula C20H13ClN4 and a molecular weight of 344.81 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(3-ethynylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-chlorophenyl)-N-(3-ethynylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18473286 |
| Molecular Formula | C20H13ClN4 |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(3-ethynylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3[nH]cc(-c4ccc(Cl)cc4)c23)c1 |
| InChI | InChI=1S/C20H13ClN4/c1-2-13-4-3-5-16(10-13)25-20-18-17(11-22-19(18)23-12-24-20)14-6-8-15(21)9-7-14/h1,3-12H,(H2,22,23,24,25) |
| InChIKey | FAHXFOIPYNVHOP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|