C16H13N3 — CID 91068757
N-(3-ethynylphenyl)-6,7-dihydroquinazolin-4-amine (PubChem CID 91068757) has the molecular formula C16H13N3 and a molecular weight of 247.30 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-6,7-dihydroquinazolin-4-amine.
| Compound Name | N-(3-ethynylphenyl)-6,7-dihydroquinazolin-4-amine |
|---|---|
| PubChem CID | 91068757 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-(3-ethynylphenyl)-6,7-dihydroquinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3c2=CCCC=3)c1 |
| InChI | InChI=1S/C16H13N3/c1-2-12-6-5-7-13(10-12)19-16-14-8-3-4-9-15(14)17-11-18-16/h1,5-11H,3-4H2,(H,17,18,19) |
| InChIKey | WCOMBUHUQCBWKS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|