C22H24N6O — CID 58147868
1-[(3S,4R)-4-amino-1-[[4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidin-3-yl]ethanone (PubChem CID 58147868) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 1-[(3S,4R)-4-amino-1-[[4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidin-3-yl]ethanone.
| Compound Name | 1-[(3S,4R)-4-amino-1-[[4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidin-3-yl]ethanone |
|---|---|
| PubChem CID | 58147868 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[(3S,4R)-4-amino-1-[[4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]piperidin-3-yl]ethanone |
| SMILES | C#Cc1cccc(Nc2ncnn3ccc(CN4CC[C@@H](N)[C@@H](C(C)=O)C4)c23)c1 |
| InChI | InChI=1S/C22H24N6O/c1-3-16-5-4-6-18(11-16)26-22-21-17(7-10-28(21)25-14-24-22)12-27-9-8-20(23)19(13-27)15(2)29/h1,4-7,10-11,14,19-20H,8-9,12-13,23H2,2H3,(H,24,25,26)/t19-,20-/m1/s1 |
| InChIKey | XTDROCICERBSHX-WOJBJXKFSA-N |
| XLogP | 2.19 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|