C25H26N6O4 — CID 75235551
1-[[4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]-4-(prop-2-enoxycarbonylamino)piperidine-3-carboxylic acid (PubChem CID 75235551) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is 1-[[4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]-4-(prop-2-enoxycarbonylamino)piperidine-3-carboxylic acid.
| Compound Name | 1-[[4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]-4-(prop-2-enoxycarbonylamino)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 75235551 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[[4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-yl]methyl]-4-(prop-2-enoxycarbonylamino)piperidine-3-carboxylic acid |
| SMILES | C#Cc1cccc(Nc2ncnn3ccc(CN4CCC(NC(=O)OCC=C)C(C(=O)O)C4)c23)c1 |
| InChI | InChI=1S/C25H26N6O4/c1-3-12-35-25(34)29-21-9-10-30(15-20(21)24(32)33)14-18-8-11-31-22(18)23(26-16-27-31)28-19-7-5-6-17(4-2)13-19/h2-3,5-8,11,13,16,20-21H,1,9-10,12,14-15H2,(H,29,34)(H,32,33)(H,26,27,28) |
| InChIKey | JHIYGJPLTHOGDJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|