C28H28N4O4 — CID 87617349
3-O-methyl 4-O-prop-2-enyl 1-[[4-(3-ethynylanilino)quinazolin-5-yl]methyl]piperidine-3,4-dicarboxylate (PubChem CID 87617349) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 3-O-methyl 4-O-prop-2-enyl 1-[[4-(3-ethynylanilino)quinazolin-5-yl]methyl]piperidine-3,4-dicarboxylate.
| Compound Name | 3-O-methyl 4-O-prop-2-enyl 1-[[4-(3-ethynylanilino)quinazolin-5-yl]methyl]piperidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 87617349 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 3-O-methyl 4-O-prop-2-enyl 1-[[4-(3-ethynylanilino)quinazolin-5-yl]methyl]piperidine-3,4-dicarboxylate |
| SMILES | C#Cc1cccc(Nc2ncnc3cccc(CN4CCC(C(=O)OCC=C)C(C(=O)OC)C4)c23)c1 |
| InChI | InChI=1S/C28H28N4O4/c1-4-14-36-28(34)22-12-13-32(17-23(22)27(33)35-3)16-20-9-7-11-24-25(20)26(30-18-29-24)31-21-10-6-8-19(5-2)15-21/h2,4,6-11,15,18,22-23H,1,12-14,16-17H2,3H3,(H,29,30,31) |
| InChIKey | ATBRHOQXEUJMHE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|