C14H10N4O — CID 135772772
4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-ol (PubChem CID 135772772) has the molecular formula C14H10N4O and a molecular weight of 250.26 g/mol. Its IUPAC name is 4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-ol.
| Compound Name | 4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-ol |
|---|---|
| PubChem CID | 135772772 |
| Molecular Formula | C14H10N4O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-(3-ethynylanilino)pyrrolo[2,1-f][1,2,4]triazin-5-ol |
| SMILES | C#Cc1cccc(Nc2ncnn3ccc(O)c23)c1 |
| InChI | InChI=1S/C14H10N4O/c1-2-10-4-3-5-11(8-10)17-14-13-12(19)6-7-18(13)16-9-15-14/h1,3-9,19H,(H,15,16,17) |
| InChIKey | DMUNFSSRLYECLT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|