C23H27F3N6O2 — CID 67956788
tert-butyl N-[1-[[4-(3,4,5-trifluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate (PubChem CID 67956788) has the molecular formula C23H27F3N6O2 and a molecular weight of 476.50 g/mol. Its IUPAC name is tert-butyl N-[1-[[4-(3,4,5-trifluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[4-(3,4,5-trifluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 67956788 |
| Molecular Formula | C23H27F3N6O2 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | tert-butyl N-[1-[[4-(3,4,5-trifluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Cc2c[nH]c3ncnc(Nc4cc(F)c(F)c(F)c4)c23)CC1 |
| InChI | InChI=1S/C23H27F3N6O2/c1-23(2,3)34-22(33)31-14-4-6-32(7-5-14)11-13-10-27-20-18(13)21(29-12-28-20)30-15-8-16(24)19(26)17(25)9-15/h8-10,12,14H,4-7,11H2,1-3H3,(H,31,33)(H2,27,28,29,30) |
| InChIKey | SMNXYHUBVAVHJN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|