C20H16FN7O — CID 162659623
6-amino-2-[3-[(2-fluorophenyl)methyl]indazol-1-yl]-7-methyl-9H-purin-8-one (PubChem CID 162659623) has the molecular formula C20H16FN7O and a molecular weight of 389.39 g/mol. Its IUPAC name is 6-amino-2-[3-[(2-fluorophenyl)methyl]indazol-1-yl]-7-methyl-9H-purin-8-one.
| Compound Name | 6-amino-2-[3-[(2-fluorophenyl)methyl]indazol-1-yl]-7-methyl-9H-purin-8-one |
|---|---|
| PubChem CID | 162659623 |
| Molecular Formula | C20H16FN7O |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 6-amino-2-[3-[(2-fluorophenyl)methyl]indazol-1-yl]-7-methyl-9H-purin-8-one |
| SMILES | Cn1c(=O)[nH]c2nc(-n3nc(Cc4ccccc4F)c4ccccc43)nc(N)c21 |
| InChI | InChI=1S/C20H16FN7O/c1-27-16-17(22)23-19(24-18(16)25-20(27)29)28-15-9-5-3-7-12(15)14(26-28)10-11-6-2-4-8-13(11)21/h2-9H,10H2,1H3,(H3,22,23,24,25,29) |
| InChIKey | AUSIWDVLYSFDBW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |