C21H18F3N7O2 — CID 123509021
[4,6-diamino-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl] N-ethylcarbamate (PubChem CID 123509021) has the molecular formula C21H18F3N7O2 and a molecular weight of 457.42 g/mol. Its IUPAC name is [4,6-diamino-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl] N-ethylcarbamate.
| Compound Name | [4,6-diamino-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 123509021 |
| Molecular Formula | C21H18F3N7O2 |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [4,6-diamino-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1c(N)nc(-n2nc(Cc3c(F)ccc(F)c3F)c3ccccc32)nc1N |
| InChI | InChI=1S/C21H18F3N7O2/c1-2-27-21(32)33-17-18(25)28-20(29-19(17)26)31-15-6-4-3-5-10(15)14(30-31)9-11-12(22)7-8-13(23)16(11)24/h3-8H,2,9H2,1H3,(H,27,32)(H4,25,26,28,29) |
| InChIKey | SBDZVBPNQXXXGM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|