C30H25N3O3S — CID 162664104
N-[[3-[(4-aminobenzoyl)amino]phenyl]methyl]-3-phenylmethoxy-1-benzothiophene-2-carboxamide (PubChem CID 162664104) has the molecular formula C30H25N3O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is N-[[3-[(4-aminobenzoyl)amino]phenyl]methyl]-3-phenylmethoxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[3-[(4-aminobenzoyl)amino]phenyl]methyl]-3-phenylmethoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 162664104 |
| Molecular Formula | C30H25N3O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | N-[[3-[(4-aminobenzoyl)amino]phenyl]methyl]-3-phenylmethoxy-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccc(C(=O)Nc2cccc(CNC(=O)c3sc4ccccc4c3OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H25N3O3S/c31-23-15-13-22(14-16-23)29(34)33-24-10-6-9-21(17-24)18-32-30(35)28-27(25-11-4-5-12-26(25)37-28)36-19-20-7-2-1-3-8-20/h1-17H,18-19,31H2,(H,32,35)(H,33,34) |
| InChIKey | WBEOJISSHRSGRB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|