C44H42N4O8S — CID 162666585
(2S)-2-[[2-(4-methylphenyl)acetyl]amino]-3-[4-(2-naphthalen-1-yloxyethoxy)phenyl]-N-[3-nitro-4-(2-phenylethylamino)phenyl]sulfonylpropanamide (PubChem CID 162666585) has the molecular formula C44H42N4O8S and a molecular weight of 786.91 g/mol. Its IUPAC name is (2S)-2-[[2-(4-methylphenyl)acetyl]amino]-3-[4-(2-naphthalen-1-yloxyethoxy)phenyl]-N-[3-nitro-4-(2-phenylethylamino)phenyl]sulfonylpropanamide.
| Compound Name | (2S)-2-[[2-(4-methylphenyl)acetyl]amino]-3-[4-(2-naphthalen-1-yloxyethoxy)phenyl]-N-[3-nitro-4-(2-phenylethylamino)phenyl]sulfonylpropanamide |
|---|---|
| PubChem CID | 162666585 |
| Molecular Formula | C44H42N4O8S |
| Molecular Weight | 786.91 g/mol |
| Exact Mass | 786.27 |
| IUPAC Name | (2S)-2-[[2-(4-methylphenyl)acetyl]amino]-3-[4-(2-naphthalen-1-yloxyethoxy)phenyl]-N-[3-nitro-4-(2-phenylethylamino)phenyl]sulfonylpropanamide |
| SMILES | Cc1ccc(CC(=O)N[C@@H](Cc2ccc(OCCOc3cccc4ccccc34)cc2)C(=O)NS(=O)(=O)c2ccc(NCCc3ccccc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C44H42N4O8S/c1-31-14-16-34(17-15-31)29-43(49)46-40(28-33-18-20-36(21-19-33)55-26-27-56-42-13-7-11-35-10-5-6-12-38(35)42)44(50)47-57(53,54)37-22-23-39(41(30-37)48(51)52)45-25-24-32-8-3-2-4-9-32/h2-23,30,40,45H,24-29H2,1H3,(H,46,49)(H,47,50)/t40-/m0/s1 |
| InChIKey | MYTOTGXIVKSRJW-FAIXQHPJSA-N |
| XLogP | 6.94 |
| TPSA | 165.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.91 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|