C32H32N4O8S — CID 175083275
[1-[[3-nitro-4-(3-phenylpropylamino)phenyl]sulfonylamino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl] carbamate (PubChem CID 175083275) has the molecular formula C32H32N4O8S and a molecular weight of 632.70 g/mol. Its IUPAC name is [1-[[3-nitro-4-(3-phenylpropylamino)phenyl]sulfonylamino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl] carbamate.
| Compound Name | [1-[[3-nitro-4-(3-phenylpropylamino)phenyl]sulfonylamino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl] carbamate |
|---|---|
| PubChem CID | 175083275 |
| Molecular Formula | C32H32N4O8S |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | [1-[[3-nitro-4-(3-phenylpropylamino)phenyl]sulfonylamino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl] carbamate |
| SMILES | NC(=O)OC(Cc1ccc(OCc2ccccc2)cc1)C(=O)NS(=O)(=O)c1ccc(NCCCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H32N4O8S/c33-32(38)44-30(20-24-13-15-26(16-14-24)43-22-25-10-5-2-6-11-25)31(37)35-45(41,42)27-17-18-28(29(21-27)36(39)40)34-19-7-12-23-8-3-1-4-9-23/h1-6,8-11,13-18,21,30,34H,7,12,19-20,22H2,(H2,33,38)(H,35,37) |
| InChIKey | WMUVGGNLPBRYNH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 179.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|