C14H18ClN3O6 — CID 162669958
(2R,3R,4S,5R)-2-[5-chloro-4-(2-methoxyethoxy)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 162669958) has the molecular formula C14H18ClN3O6 and a molecular weight of 359.77 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[5-chloro-4-(2-methoxyethoxy)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[5-chloro-4-(2-methoxyethoxy)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 162669958 |
| Molecular Formula | C14H18ClN3O6 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-[5-chloro-4-(2-methoxyethoxy)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | COCCOc1ncnc2c1c(Cl)cn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H18ClN3O6/c1-22-2-3-23-13-9-7(15)4-18(12(9)16-6-17-13)14-11(21)10(20)8(5-19)24-14/h4,6,8,10-11,14,19-21H,2-3,5H2,1H3/t8-,10-,11-,14-/m1/s1 |
| InChIKey | YOJCIAGQACVPEW-IDTAVKCVSA-N |
| XLogP | -0.28 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|