C36H27BBrF2N3O — CID 162673300
6-bromo-3,3-difluoro-17-methoxy-5-(4-methylphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaene (PubChem CID 162673300) has the molecular formula C36H27BBrF2N3O and a molecular weight of 646.34 g/mol. Its IUPAC name is 6-bromo-3,3-difluoro-17-methoxy-5-(4-methylphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaene.
| Compound Name | 6-bromo-3,3-difluoro-17-methoxy-5-(4-methylphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaene |
|---|---|
| PubChem CID | 162673300 |
| Molecular Formula | C36H27BBrF2N3O |
| Molecular Weight | 646.34 g/mol |
| Exact Mass | 645.14 |
| IUPAC Name | 6-bromo-3,3-difluoro-17-methoxy-5-(4-methylphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaene |
| SMILES | COc1ccc2c(c1)CCc1c(-c3ccccc3)c3n(c1-2)[B-](F)(F)[N+]1=C(c2ccc(C)cc2)C(Br)=C(c2ccccc2)C1=N3 |
| InChI | InChI=1S/C36H27BBrF2N3O/c1-22-13-15-25(16-14-22)33-32(38)31(24-11-7-4-8-12-24)36-41-35-30(23-9-5-3-6-10-23)29-19-17-26-21-27(44-2)18-20-28(26)34(29)43(35)37(39,40)42(33)36/h3-16,18,20-21H,17,19H2,1-2H3 |
| InChIKey | CRBDUORIGDAPAQ-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 29.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.34 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|