C27H23Cl2N7O — CID 162673511
4-[[2-amino-4-[(3,4-dichlorophenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]methyl]-N-(2-aminophenyl)benzamide (PubChem CID 162673511) has the molecular formula C27H23Cl2N7O and a molecular weight of 532.44 g/mol. Its IUPAC name is 4-[[2-amino-4-[(3,4-dichlorophenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]methyl]-N-(2-aminophenyl)benzamide.
| Compound Name | 4-[[2-amino-4-[(3,4-dichlorophenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]methyl]-N-(2-aminophenyl)benzamide |
|---|---|
| PubChem CID | 162673511 |
| Molecular Formula | C27H23Cl2N7O |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 4-[[2-amino-4-[(3,4-dichlorophenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]methyl]-N-(2-aminophenyl)benzamide |
| SMILES | Nc1nc(NCc2ccc(Cl)c(Cl)c2)c2ccn(Cc3ccc(C(=O)Nc4ccccc4N)cc3)c2n1 |
| InChI | InChI=1S/C27H23Cl2N7O/c28-20-10-7-17(13-21(20)29)14-32-24-19-11-12-36(25(19)35-27(31)34-24)15-16-5-8-18(9-6-16)26(37)33-23-4-2-1-3-22(23)30/h1-13H,14-15,30H2,(H,33,37)(H3,31,32,34,35) |
| InChIKey | QKZBNMDAMADGKW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|