C21H18N2O5S — CID 162676312
7-[[5-[(4-methoxyphenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methoxy]-4-methylchromen-2-one (PubChem CID 162676312) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is 7-[[5-[(4-methoxyphenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[[5-[(4-methoxyphenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 162676312 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 7-[[5-[(4-methoxyphenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methoxy]-4-methylchromen-2-one |
| SMILES | COc1ccc(CSc2nnc(COc3ccc4c(C)cc(=O)oc4c3)o2)cc1 |
| InChI | InChI=1S/C21H18N2O5S/c1-13-9-20(24)27-18-10-16(7-8-17(13)18)26-11-19-22-23-21(28-19)29-12-14-3-5-15(25-2)6-4-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | FNFOVWUPMKDVAC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 87.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|