C19H22Cl2N2O4 — CID 162676417
N-[4-[bis(3-hydroxypropyl)amino]-2-chlorophenyl]-5-chloro-2-hydroxybenzamide (PubChem CID 162676417) has the molecular formula C19H22Cl2N2O4 and a molecular weight of 413.30 g/mol. Its IUPAC name is N-[4-[bis(3-hydroxypropyl)amino]-2-chlorophenyl]-5-chloro-2-hydroxybenzamide.
| Compound Name | N-[4-[bis(3-hydroxypropyl)amino]-2-chlorophenyl]-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 162676417 |
| Molecular Formula | C19H22Cl2N2O4 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[4-[bis(3-hydroxypropyl)amino]-2-chlorophenyl]-5-chloro-2-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(N(CCCO)CCCO)cc1Cl)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C19H22Cl2N2O4/c20-13-3-6-18(26)15(11-13)19(27)22-17-5-4-14(12-16(17)21)23(7-1-9-24)8-2-10-25/h3-6,11-12,24-26H,1-2,7-10H2,(H,22,27) |
| InChIKey | AJQDPEKNKHMPTK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |